C13H22O2 — CID 10727184
(3aR,4S,7aS)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 10727184) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (3aR,4S,7aS)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (3aR,4S,7aS)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 10727184 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (3aR,4S,7aS)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](CO)C1=CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C13H22O2/c1-9(8-14)10-5-6-11-12(15)4-3-7-13(10,11)2/h5,9,11-12,14-15H,3-4,6-8H2,1-2H3/t9-,11+,12+,13-/m1/s1 |
| InChIKey | YXTDEPSWQLJFBO-LPTSXCQYSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|