About cyano(ethoxy)phosphinate;trimethylsulfanium
cyano(ethoxy)phosphinate;trimethylsulfanium (PubChem CID 10727206) has the molecular formula C6H14NO3PS
and a molecular weight of 211.22 g/mol. Its IUPAC name is cyano(ethoxy)phosphinate;trimethylsulfanium.
Molecular Properties
| Compound Name | cyano(ethoxy)phosphinate;trimethylsulfanium |
| PubChem CID | 10727206 |
| Molecular Formula | C6H14NO3PS |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | cyano(ethoxy)phosphinate;trimethylsulfanium |
| SMILES | CCOP(=O)([O-])C#N.C[S+](C)C |
| InChI | InChI=1S/C3H6NO3P.C3H9S/c1-2-7-8(5,6)3-4;1-4(2)3/h2H2,1H3,(H,5,6);1-3H3/q;+1/p-1 |
| InChIKey | IFDYUENQDILKPA-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyano(ethoxy)phosphinate;trimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano(ethoxy)phosphinate;trimethylsulfanium?
The IUPAC name of cyano(ethoxy)phosphinate;trimethylsulfanium (CID 10727206) is cyano(ethoxy)phosphinate;trimethylsulfanium.
What is the SMILES notation for cyano(ethoxy)phosphinate;trimethylsulfanium?
The canonical SMILES for cyano(ethoxy)phosphinate;trimethylsulfanium is CCOP(=O)([O-])C#N.C[S+](C)C.
What is the InChIKey of cyano(ethoxy)phosphinate;trimethylsulfanium?
The InChIKey is IFDYUENQDILKPA-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6NO3P.C3H9S/c1-2-7-8(5,6)3-4;1-4(2)3/h2H2,1H3,(H,5,6);1-3H3/q;+1/p-1.
What are the key properties of cyano(ethoxy)phosphinate;trimethylsulfanium?
cyano(ethoxy)phosphinate;trimethylsulfanium has a molecular weight of 211.22 g/mol, XLogP of 0.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyano(ethoxy)phosphinate;trimethylsulfanium is sourced from PubChem (CID 10727206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).