About ethyl (Z)-undec-2-enoate
ethyl (Z)-undec-2-enoate (PubChem CID 10727281) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is ethyl (Z)-undec-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-undec-2-enoate |
| PubChem CID | 10727281 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethyl (Z)-undec-2-enoate |
| SMILES | CCCCCCCC/C=C\C(=O)OCC |
| InChI | InChI=1S/C13H24O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h11-12H,3-10H2,1-2H3/b12-11- |
| InChIKey | PERJJPDPIXBRBO-QXMHVHEDSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-undec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-undec-2-enoate?
The IUPAC name of ethyl (Z)-undec-2-enoate (CID 10727281) is ethyl (Z)-undec-2-enoate.
What is the SMILES notation for ethyl (Z)-undec-2-enoate?
The canonical SMILES for ethyl (Z)-undec-2-enoate is CCCCCCCC/C=C\C(=O)OCC.
What is the InChIKey of ethyl (Z)-undec-2-enoate?
The InChIKey is PERJJPDPIXBRBO-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H24O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h11-12H,3-10H2,1-2H3/b12-11-.
What are the key properties of ethyl (Z)-undec-2-enoate?
ethyl (Z)-undec-2-enoate has a molecular weight of 212.33 g/mol, XLogP of 3.86, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-undec-2-enoate is sourced from PubChem (CID 10727281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).