C9H10O6 — CID 10727338
(5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2,3,4-trione (PubChem CID 10727338) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is (5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2,3,4-trione.
| Compound Name | (5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2,3,4-trione |
|---|---|
| PubChem CID | 10727338 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolane-2,3,4-trione |
| SMILES | CC1(C)OC[C@@H]([C@H]2OC(=O)C(=O)C2=O)O1 |
| InChI | InChI=1S/C9H10O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4,7H,3H2,1-2H3/t4-,7+/m0/s1 |
| InChIKey | XTXAVJYXLXJPPA-MHTLYPKNSA-N |
| XLogP | -0.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|