C15H22N2O3 — CID 107273592
3-[2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]propanoic acid (PubChem CID 107273592) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-[2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 107273592 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-[2-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1ccccc1CCC(=O)O |
| InChI | InChI=1S/C15H22N2O3/c1-15(2,3)13(16)14(20)17-11-7-5-4-6-10(11)8-9-12(18)19/h4-7,13H,8-9,16H2,1-3H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | OAGSXUYVVJACNF-ZDUSSCGKSA-N |
| XLogP | 2.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |