C14H15N5O — CID 107273700
2-[2-(2-aminophenyl)ethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 107273700) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[2-(2-aminophenyl)ethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-[2-(2-aminophenyl)ethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 107273700 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[2-(2-aminophenyl)ethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(CCc3ccccc3N)nc2n1 |
| InChI | InChI=1S/C14H15N5O/c1-9-8-13(20)19-14(16-9)17-12(18-19)7-6-10-4-2-3-5-11(10)15/h2-5,8H,6-7,15H2,1H3,(H,16,17,18) |
| InChIKey | ODKZLANUKUYKAK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|