C15H13FN4O — CID 107273782
2-[2-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]aniline (PubChem CID 107273782) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[2-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]aniline.
| Compound Name | 2-[2-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]aniline |
|---|---|
| PubChem CID | 107273782 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[2-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]aniline |
| SMILES | Nc1ccccc1CCc1nc(-c2ccc(F)cn2)no1 |
| InChI | InChI=1S/C15H13FN4O/c16-11-6-7-13(18-9-11)15-19-14(21-20-15)8-5-10-3-1-2-4-12(10)17/h1-4,6-7,9H,5,8,17H2 |
| InChIKey | GMUWUJSZIPKQKB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|