C14H19NO — CID 10727514
(4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10727514) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10727514 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
| SMILES | c1ccc(C2NC[C@H]3CCCC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C14H19NO/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-3,6-7,12-15H,4-5,8-10H2/t12-,13+,14?/m1/s1 |
| InChIKey | YGWVKHFWNJMREB-AMIUJLCOSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |