About N-butyl-2,1,3-benzoxadiazole-5-carboxamide
N-butyl-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 10727591) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is N-butyl-2,1,3-benzoxadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-butyl-2,1,3-benzoxadiazole-5-carboxamide |
| PubChem CID | 10727591 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-butyl-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2nonc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-3-6-12-11(15)8-4-5-9-10(7-8)14-16-13-9/h4-5,7H,2-3,6H2,1H3,(H,12,15) |
| InChIKey | CQZPMPAHAOEURE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,1,3-benzoxadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,1,3-benzoxadiazole-5-carboxamide?
The IUPAC name of N-butyl-2,1,3-benzoxadiazole-5-carboxamide (CID 10727591) is N-butyl-2,1,3-benzoxadiazole-5-carboxamide.
What is the SMILES notation for N-butyl-2,1,3-benzoxadiazole-5-carboxamide?
The canonical SMILES for N-butyl-2,1,3-benzoxadiazole-5-carboxamide is CCCCNC(=O)c1ccc2nonc2c1.
What is the InChIKey of N-butyl-2,1,3-benzoxadiazole-5-carboxamide?
The InChIKey is CQZPMPAHAOEURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-2-3-6-12-11(15)8-4-5-9-10(7-8)14-16-13-9/h4-5,7H,2-3,6H2,1H3,(H,12,15).
What are the key properties of N-butyl-2,1,3-benzoxadiazole-5-carboxamide?
N-butyl-2,1,3-benzoxadiazole-5-carboxamide has a molecular weight of 219.24 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,1,3-benzoxadiazole-5-carboxamide is sourced from PubChem (CID 10727591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).