C13H16O3 — CID 10727636
(1'R,2'S,6'R,7'S)-1'-methylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 10727636) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (1'R,2'S,6'R,7'S)-1'-methylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'R,2'S,6'R,7'S)-1'-methylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 10727636 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (1'R,2'S,6'R,7'S)-1'-methylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | C[C@]12CCC3(OCCO3)[C@H]1[C@@H]1C=CC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H16O3/c1-12-4-5-13(15-6-7-16-13)11(12)8-2-3-9(14)10(8)12/h2-3,8,10-11H,4-7H2,1H3/t8-,10-,11+,12-/m1/s1 |
| InChIKey | OBZZTFCFJPRNFL-KXGXSXBTSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |