C13H15BrN2S — CID 107276558
2-bromo-4-[(2-methylthiolan-2-yl)methylamino]benzonitrile (PubChem CID 107276558) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-bromo-4-[(2-methylthiolan-2-yl)methylamino]benzonitrile.
| Compound Name | 2-bromo-4-[(2-methylthiolan-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 107276558 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-bromo-4-[(2-methylthiolan-2-yl)methylamino]benzonitrile |
| SMILES | CC1(CNc2ccc(C#N)c(Br)c2)CCCS1 |
| InChI | InChI=1S/C13H15BrN2S/c1-13(5-2-6-17-13)9-16-11-4-3-10(8-15)12(14)7-11/h3-4,7,16H,2,5-6,9H2,1H3 |
| InChIKey | OTEZDHQCPDBLLM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |