C14H19BrN2OS — CID 107277466
2-bromo-4-[methyl(oxan-2-ylmethyl)amino]benzenecarbothioamide (PubChem CID 107277466) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-bromo-4-[methyl(oxan-2-ylmethyl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-4-[methyl(oxan-2-ylmethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107277466 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-bromo-4-[methyl(oxan-2-ylmethyl)amino]benzenecarbothioamide |
| SMILES | CN(CC1CCCCO1)c1ccc(C(N)=S)c(Br)c1 |
| InChI | InChI=1S/C14H19BrN2OS/c1-17(9-11-4-2-3-7-18-11)10-5-6-12(14(16)19)13(15)8-10/h5-6,8,11H,2-4,7,9H2,1H3,(H2,16,19) |
| InChIKey | AXCLDQGLEIALAA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|