About 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole
5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole (PubChem CID 10727862) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole.
Molecular Properties
| Compound Name | 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole |
| PubChem CID | 10727862 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole |
| SMILES | Cc1cc(C)c2c(c1)C(c1cnc[nH]1)=CCC2 |
| InChI | InChI=1S/C15H16N2/c1-10-6-11(2)12-4-3-5-13(14(12)7-10)15-8-16-9-17-15/h5-9H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | GQDXDQJDNRRLRK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole?
The IUPAC name of 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole (CID 10727862) is 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole.
What is the SMILES notation for 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole?
The canonical SMILES for 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole is Cc1cc(C)c2c(c1)C(c1cnc[nH]1)=CCC2.
What is the InChIKey of 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole?
The InChIKey is GQDXDQJDNRRLRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-10-6-11(2)12-4-3-5-13(14(12)7-10)15-8-16-9-17-15/h5-9H,3-4H2,1-2H3,(H,16,17).
What are the key properties of 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole?
5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole has a molecular weight of 224.31 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)-1H-imidazole is sourced from PubChem (CID 10727862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).