C14H22BrN3O3 — CID 107278647
2-bromo-N'-hydroxy-4-[2-methoxyethyl(3-methoxypropyl)amino]benzenecarboximidamide (PubChem CID 107278647) has the molecular formula C14H22BrN3O3 and a molecular weight of 360.25 g/mol. Its IUPAC name is 2-bromo-N'-hydroxy-4-[2-methoxyethyl(3-methoxypropyl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-N'-hydroxy-4-[2-methoxyethyl(3-methoxypropyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107278647 |
| Molecular Formula | C14H22BrN3O3 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-bromo-N'-hydroxy-4-[2-methoxyethyl(3-methoxypropyl)amino]benzenecarboximidamide |
| SMILES | COCCCN(CCOC)c1ccc(/C(N)=N/O)c(Br)c1 |
| InChI | InChI=1S/C14H22BrN3O3/c1-20-8-3-6-18(7-9-21-2)11-4-5-12(13(15)10-11)14(16)17-19/h4-5,10,19H,3,6-9H2,1-2H3,(H2,16,17) |
| InChIKey | YKRPEFWTQIILCN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|