C15H25BrN4 — CID 107279228
2-bromo-4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]benzenecarboximidamide (PubChem CID 107279228) has the molecular formula C15H25BrN4 and a molecular weight of 341.30 g/mol. Its IUPAC name is 2-bromo-4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107279228 |
| Molecular Formula | C15H25BrN4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-bromo-4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(CCN(C)C)CC(C)C)cc1Br |
| InChI | InChI=1S/C15H25BrN4/c1-11(2)10-20(8-7-19(3)4)12-5-6-13(15(17)18)14(16)9-12/h5-6,9,11H,7-8,10H2,1-4H3,(H3,17,18) |
| InChIKey | JESXVMCERDHATJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|