C15H23BrN4 — CID 107279306
2-bromo-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzenecarboximidamide (PubChem CID 107279306) has the molecular formula C15H23BrN4 and a molecular weight of 339.28 g/mol. Its IUPAC name is 2-bromo-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzenecarboximidamide.
| Compound Name | 2-bromo-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107279306 |
| Molecular Formula | C15H23BrN4 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-bromo-4-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CC2CCN(C)CC2)cc1Br |
| InChI | InChI=1S/C15H23BrN4/c1-19-7-5-11(6-8-19)10-20(2)12-3-4-13(15(17)18)14(16)9-12/h3-4,9,11H,5-8,10H2,1-2H3,(H3,17,18) |
| InChIKey | GCGITFOZYAABHR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|