C12H18O4 — CID 10727935
(2S,3aR,6aR)-2-cyclohexyl-3a-hydroxy-2,3,4,6a-tetrahydrofuro[2,3-b]furan-5-one (PubChem CID 10727935) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2S,3aR,6aR)-2-cyclohexyl-3a-hydroxy-2,3,4,6a-tetrahydrofuro[2,3-b]furan-5-one.
| Compound Name | (2S,3aR,6aR)-2-cyclohexyl-3a-hydroxy-2,3,4,6a-tetrahydrofuro[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 10727935 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2S,3aR,6aR)-2-cyclohexyl-3a-hydroxy-2,3,4,6a-tetrahydrofuro[2,3-b]furan-5-one |
| SMILES | O=C1C[C@]2(O)C[C@@H](C3CCCCC3)O[C@@H]2O1 |
| InChI | InChI=1S/C12H18O4/c13-10-7-12(14)6-9(15-11(12)16-10)8-4-2-1-3-5-8/h8-9,11,14H,1-7H2/t9-,11+,12+/m0/s1 |
| InChIKey | LSGYSFZCXHBVEK-MVWJERBFSA-N |
| XLogP | 1.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |