C10H12O6 — CID 10728029
(5E,6R)-4-(carboxymethyl)-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylic acid (PubChem CID 10728029) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is (5E,6R)-4-(carboxymethyl)-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylic acid.
| Compound Name | (5E,6R)-4-(carboxymethyl)-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 10728029 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (5E,6R)-4-(carboxymethyl)-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylic acid |
| SMILES | C/C=C1\C(CC(=O)O)C(C(=O)O)=CO[C@H]1O |
| InChI | InChI=1S/C10H12O6/c1-2-5-6(3-8(11)12)7(9(13)14)4-16-10(5)15/h2,4,6,10,15H,3H2,1H3,(H,11,12)(H,13,14)/b5-2+/t6?,10-/m1/s1 |
| InChIKey | AIOOLCVTWYPCAE-NRQSGWDVSA-N |
| XLogP | 0.34 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|