C15H20BrN3O2 — CID 107280373
tert-butyl N-[3-(3-bromo-4-cyanoanilino)propyl]carbamate (PubChem CID 107280373) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromo-4-cyanoanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-bromo-4-cyanoanilino)propyl]carbamate |
|---|---|
| PubChem CID | 107280373 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | tert-butyl N-[3-(3-bromo-4-cyanoanilino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc(C#N)c(Br)c1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-15(2,3)21-14(20)19-8-4-7-18-12-6-5-11(10-17)13(16)9-12/h5-6,9,18H,4,7-8H2,1-3H3,(H,19,20) |
| InChIKey | DMVKMJKTCSBQQU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|