About 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide
4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide (PubChem CID 107280604) has the molecular formula C16H16BrN3O
and a molecular weight of 346.23 g/mol. Its IUPAC name is 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide.
Molecular Properties
| Compound Name | 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide |
| PubChem CID | 107280604 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide |
| SMILES | NC(=O)c1ccc(N2CCc3c(N)cccc3C2)cc1Br |
| InChI | InChI=1S/C16H16BrN3O/c17-14-8-11(4-5-13(14)16(19)21)20-7-6-12-10(9-20)2-1-3-15(12)18/h1-5,8H,6-7,9,18H2,(H2,19,21) |
| InChIKey | YTHOFJXYKCZDAU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide?
The IUPAC name of 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide (CID 107280604) is 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide.
What is the SMILES notation for 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide?
The canonical SMILES for 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide is NC(=O)c1ccc(N2CCc3c(N)cccc3C2)cc1Br.
What is the InChIKey of 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide?
The InChIKey is YTHOFJXYKCZDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrN3O/c17-14-8-11(4-5-13(14)16(19)21)20-7-6-12-10(9-20)2-1-3-15(12)18/h1-5,8H,6-7,9,18H2,(H2,19,21).
What are the key properties of 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide?
4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide has a molecular weight of 346.23 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-bromobenzamide is sourced from PubChem (CID 107280604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).