About ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate
ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate (PubChem CID 10728148) has the molecular formula C10H14O6
and a molecular weight of 230.22 g/mol. Its IUPAC name is ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate |
| PubChem CID | 10728148 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@@H]1OC(=O)O[C@@H]1C=O |
| InChI | InChI=1S/C10H14O6/c1-2-14-9(12)5-3-4-7-8(6-11)16-10(13)15-7/h6-8H,2-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | PLGBWUCKIJYHOZ-JGVFFNPUSA-N |
| XLogP | 0.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate?
The IUPAC name of ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate (CID 10728148) is ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate.
What is the SMILES notation for ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate?
The canonical SMILES for ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate is CCOC(=O)CCC[C@@H]1OC(=O)O[C@@H]1C=O.
What is the InChIKey of ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate?
The InChIKey is PLGBWUCKIJYHOZ-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H14O6/c1-2-14-9(12)5-3-4-7-8(6-11)16-10(13)15-7/h6-8H,2-5H2,1H3/t7-,8+/m0/s1.
What are the key properties of ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate?
ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate has a molecular weight of 230.22 g/mol, XLogP of 0.82, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(4S,5S)-5-formyl-2-oxo-1,3-dioxolan-4-yl]butanoate is sourced from PubChem (CID 10728148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).