C15H20O2 — CID 10728290
5-(2-hydroxyethyl)-2,2,4,6-tetramethyl-3H-inden-1-one (PubChem CID 10728290) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2,2,4,6-tetramethyl-3H-inden-1-one.
| Compound Name | 5-(2-hydroxyethyl)-2,2,4,6-tetramethyl-3H-inden-1-one |
|---|---|
| PubChem CID | 10728290 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 5-(2-hydroxyethyl)-2,2,4,6-tetramethyl-3H-inden-1-one |
| SMILES | Cc1cc2c(c(C)c1CCO)CC(C)(C)C2=O |
| InChI | InChI=1S/C15H20O2/c1-9-7-12-13(8-15(3,4)14(12)17)10(2)11(9)5-6-16/h7,16H,5-6,8H2,1-4H3 |
| InChIKey | NUFTYHHRGFEVPH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |