C10H10F3NO2 — CID 10728323
2,2,2-trifluoro-1-[(1R,5R,7R)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]ethanone (PubChem CID 10728323) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(1R,5R,7R)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(1R,5R,7R)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]ethanone |
|---|---|
| PubChem CID | 10728323 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,2,2-trifluoro-1-[(1R,5R,7R)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]ethanone |
| SMILES | O=C(N1C[C@H]2C[C@@H]3C=C[C@@]2(C1)O3)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2/c11-10(12,13)8(15)14-4-6-3-7-1-2-9(6,5-14)16-7/h1-2,6-7H,3-5H2/t6-,7+,9+/m1/s1 |
| InChIKey | SXCBNHFVDMVVRT-FJXKBIBVSA-N |
| XLogP | 1.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|