C15H23NO — CID 10728357
N-ethyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine (PubChem CID 10728357) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-ethyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine.
| Compound Name | N-ethyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10728357 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-ethyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine |
| SMILES | CCNc1c(C)c(C)c2c(c1C)CC(C)(C)O2 |
| InChI | InChI=1S/C15H23NO/c1-7-16-13-9(2)10(3)14-12(11(13)4)8-15(5,6)17-14/h16H,7-8H2,1-6H3 |
| InChIKey | OLMZSAXQYVJLLR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|