C13H20BrNO2 — CID 107283637
1-(5-bromo-2-methylphenoxy)-3-(ethylamino)-2-methylpropan-2-ol (PubChem CID 107283637) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenoxy)-3-(ethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-(5-bromo-2-methylphenoxy)-3-(ethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 107283637 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-(5-bromo-2-methylphenoxy)-3-(ethylamino)-2-methylpropan-2-ol |
| SMILES | CCNCC(C)(O)COc1cc(Br)ccc1C |
| InChI | InChI=1S/C13H20BrNO2/c1-4-15-8-13(3,16)9-17-12-7-11(14)6-5-10(12)2/h5-7,15-16H,4,8-9H2,1-3H3 |
| InChIKey | YWLBGCUXOYICQC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |