About ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate
ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 10728450) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| PubChem CID | 10728450 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1CCCc2c1ccc(O)c2C |
| InChI | InChI=1S/C13H17NO3/c1-3-17-13(16)14-8-4-5-10-9(2)12(15)7-6-11(10)14/h6-7,15H,3-5,8H2,1-2H3 |
| InChIKey | XMRFBADRCQXLAP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (CID 10728450) is ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate is CCOC(=O)N1CCCc2c1ccc(O)c2C.
What is the InChIKey of ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is XMRFBADRCQXLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-3-17-13(16)14-8-4-5-10-9(2)12(15)7-6-11(10)14/h6-7,15H,3-5,8H2,1-2H3.
What are the key properties of ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate?
ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 235.28 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-hydroxy-5-methyl-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 10728450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).