C12H18BrNO — CID 107285213
3-(5-bromo-2-methylphenoxy)-N,2-dimethylpropan-1-amine (PubChem CID 107285213) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-(5-bromo-2-methylphenoxy)-N,2-dimethylpropan-1-amine.
| Compound Name | 3-(5-bromo-2-methylphenoxy)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 107285213 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(5-bromo-2-methylphenoxy)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)COc1cc(Br)ccc1C |
| InChI | InChI=1S/C12H18BrNO/c1-9(7-14-3)8-15-12-6-11(13)5-4-10(12)2/h4-6,9,14H,7-8H2,1-3H3 |
| InChIKey | WDYZOMUQHNNKNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |