About methyl 2-methyltrideca-2,3,12-trienoate
methyl 2-methyltrideca-2,3,12-trienoate (PubChem CID 10728529) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is methyl 2-methyltrideca-2,3,12-trienoate.
Molecular Properties
| Compound Name | methyl 2-methyltrideca-2,3,12-trienoate |
| PubChem CID | 10728529 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | methyl 2-methyltrideca-2,3,12-trienoate |
| SMILES | C=CCCCCCCCC=C=C(C)C(=O)OC |
| InChI | InChI=1S/C15H24O2/c1-4-5-6-7-8-9-10-11-12-13-14(2)15(16)17-3/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | YSUANJQEUNXANV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyltrideca-2,3,12-trienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyltrideca-2,3,12-trienoate?
The IUPAC name of methyl 2-methyltrideca-2,3,12-trienoate (CID 10728529) is methyl 2-methyltrideca-2,3,12-trienoate.
What is the SMILES notation for methyl 2-methyltrideca-2,3,12-trienoate?
The canonical SMILES for methyl 2-methyltrideca-2,3,12-trienoate is C=CCCCCCCCC=C=C(C)C(=O)OC.
What is the InChIKey of methyl 2-methyltrideca-2,3,12-trienoate?
The InChIKey is YSUANJQEUNXANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-4-5-6-7-8-9-10-11-12-13-14(2)15(16)17-3/h4,12H,1,5-11H2,2-3H3.
What are the key properties of methyl 2-methyltrideca-2,3,12-trienoate?
methyl 2-methyltrideca-2,3,12-trienoate has a molecular weight of 236.35 g/mol, XLogP of 4.18, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyltrideca-2,3,12-trienoate is sourced from PubChem (CID 10728529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).