C12H13BrF3NO2 — CID 107285477
3-[5-bromo-N-methyl-2-(trifluoromethyl)anilino]-2-methylpropanoic acid (PubChem CID 107285477) has the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. Its IUPAC name is 3-[5-bromo-N-methyl-2-(trifluoromethyl)anilino]-2-methylpropanoic acid.
| Compound Name | 3-[5-bromo-N-methyl-2-(trifluoromethyl)anilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 107285477 |
| Molecular Formula | C12H13BrF3NO2 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 3-[5-bromo-N-methyl-2-(trifluoromethyl)anilino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)c1cc(Br)ccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H13BrF3NO2/c1-7(11(18)19)6-17(2)10-5-8(13)3-4-9(10)12(14,15)16/h3-5,7H,6H2,1-2H3,(H,18,19) |
| InChIKey | CMAWSTWGAVYJPU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |