C14H16BrF3N2O — CID 107286522
2-[5-bromo-2-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 107286522) has the molecular formula C14H16BrF3N2O and a molecular weight of 365.19 g/mol. Its IUPAC name is 2-[5-bromo-2-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-[5-bromo-2-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 107286522 |
| Molecular Formula | C14H16BrF3N2O |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-[5-bromo-2-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(Nc1cc(Br)ccc1C(F)(F)F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H16BrF3N2O/c1-9(13(21)20-6-2-3-7-20)19-12-8-10(15)4-5-11(12)14(16,17)18/h4-5,8-9,19H,2-3,6-7H2,1H3 |
| InChIKey | UFQSBTBFVSKHDD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |