C14H18BrNO — CID 107287166
N-[(4-bromo-7-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine (PubChem CID 107287166) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is N-[(4-bromo-7-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(4-bromo-7-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107287166 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-[(4-bromo-7-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine |
| SMILES | Cc1ccc(Br)c2cc(CNCC(C)C)oc12 |
| InChI | InChI=1S/C14H18BrNO/c1-9(2)7-16-8-11-6-12-13(15)5-4-10(3)14(12)17-11/h4-6,9,16H,7-8H2,1-3H3 |
| InChIKey | XPQZYXUTDPMVFU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |