About (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol
(4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 107287207) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 107287207 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1ccc(Br)c2c1OCC[C@@H]2O |
| InChI | InChI=1S/C10H11BrO2/c1-6-2-3-7(11)9-8(12)4-5-13-10(6)9/h2-3,8,12H,4-5H2,1H3/t8-/m0/s1 |
| InChIKey | HEFXRLFLYCHYKT-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol (CID 107287207) is (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol is Cc1ccc(Br)c2c1OCC[C@@H]2O.
What is the InChIKey of (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is HEFXRLFLYCHYKT-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-6-2-3-7(11)9-8(12)4-5-13-10(6)9/h2-3,8,12H,4-5H2,1H3/t8-/m0/s1.
What are the key properties of (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol?
(4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 243.10 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-bromo-8-methyl-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 107287207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).