C14H16F4OS — CID 107288481
2-cyclopentylsulfanyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol (PubChem CID 107288481) has the molecular formula C14H16F4OS and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-cyclopentylsulfanyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 107288481 |
| Molecular Formula | C14H16F4OS |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(CSC1CCCC1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F4OS/c15-12-6-5-9(7-11(12)14(16,17)18)13(19)8-20-10-3-1-2-4-10/h5-7,10,13,19H,1-4,8H2 |
| InChIKey | FNOCAQWSPOPNFO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |