C13H13F3O — CID 10728849
[(1E,3E)-4-ethoxy-3-(trifluoromethyl)buta-1,3-dienyl]benzene (PubChem CID 10728849) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is [(1E,3E)-4-ethoxy-3-(trifluoromethyl)buta-1,3-dienyl]benzene.
| Compound Name | [(1E,3E)-4-ethoxy-3-(trifluoromethyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 10728849 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [(1E,3E)-4-ethoxy-3-(trifluoromethyl)buta-1,3-dienyl]benzene |
| SMILES | CCO/C=C(\C=C\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O/c1-2-17-10-12(13(14,15)16)9-8-11-6-4-3-5-7-11/h3-10H,2H2,1H3/b9-8+,12-10+ |
| InChIKey | XCYQGUVJMWFUAW-CDKJVOIVSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|