About 5-decyl-1,3-oxathiolan-2-one
5-decyl-1,3-oxathiolan-2-one (PubChem CID 10729013) has the molecular formula C13H24O2S
and a molecular weight of 244.40 g/mol. Its IUPAC name is 5-decyl-1,3-oxathiolan-2-one.
Molecular Properties
| Compound Name | 5-decyl-1,3-oxathiolan-2-one |
| PubChem CID | 10729013 |
| Molecular Formula | C13H24O2S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 5-decyl-1,3-oxathiolan-2-one |
| SMILES | CCCCCCCCCCC1CSC(=O)O1 |
| InChI | InChI=1S/C13H24O2S/c1-2-3-4-5-6-7-8-9-10-12-11-16-13(14)15-12/h12H,2-11H2,1H3 |
| InChIKey | UHPLNTFICBJQNR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-decyl-1,3-oxathiolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-decyl-1,3-oxathiolan-2-one?
The IUPAC name of 5-decyl-1,3-oxathiolan-2-one (CID 10729013) is 5-decyl-1,3-oxathiolan-2-one.
What is the SMILES notation for 5-decyl-1,3-oxathiolan-2-one?
The canonical SMILES for 5-decyl-1,3-oxathiolan-2-one is CCCCCCCCCCC1CSC(=O)O1.
What is the InChIKey of 5-decyl-1,3-oxathiolan-2-one?
The InChIKey is UHPLNTFICBJQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2S/c1-2-3-4-5-6-7-8-9-10-12-11-16-13(14)15-12/h12H,2-11H2,1H3.
What are the key properties of 5-decyl-1,3-oxathiolan-2-one?
5-decyl-1,3-oxathiolan-2-one has a molecular weight of 244.40 g/mol, XLogP of 4.77, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-decyl-1,3-oxathiolan-2-one is sourced from PubChem (CID 10729013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).