C15H21F4N — CID 107290244
3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-(2-methylpropyl)propan-1-amine (PubChem CID 107290244) has the molecular formula C15H21F4N and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-(2-methylpropyl)propan-1-amine.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-(2-methylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 107290244 |
| Molecular Formula | C15H21F4N |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-(2-methylpropyl)propan-1-amine |
| SMILES | CC(C)CNCC(C)Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F4N/c1-10(2)8-20-9-11(3)6-12-4-5-14(16)13(7-12)15(17,18)19/h4-5,7,10-11,20H,6,8-9H2,1-3H3 |
| InChIKey | BWSNBVINXDSAAO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |