C14H13F4N3 — CID 107290514
N-ethyl-4-[3-fluoro-4-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine (PubChem CID 107290514) has the molecular formula C14H13F4N3 and a molecular weight of 299.27 g/mol. Its IUPAC name is N-ethyl-4-[3-fluoro-4-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine.
| Compound Name | N-ethyl-4-[3-fluoro-4-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 107290514 |
| Molecular Formula | C14H13F4N3 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-ethyl-4-[3-fluoro-4-(trifluoromethyl)phenyl]-6-methylpyrimidin-2-amine |
| SMILES | CCNc1nc(C)cc(-c2ccc(C(F)(F)F)c(F)c2)n1 |
| InChI | InChI=1S/C14H13F4N3/c1-3-19-13-20-8(2)6-12(21-13)9-4-5-10(11(15)7-9)14(16,17)18/h4-7H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | NQBDDDAZXFOFIJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |