C14H18F4N2O — CID 107292381
[[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methyloxan-2-yl)methyl]hydrazine (PubChem CID 107292381) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is [[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methyloxan-2-yl)methyl]hydrazine.
| Compound Name | [[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methyloxan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107292381 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methyloxan-2-yl)methyl]hydrazine |
| SMILES | CC1(C(NN)c2ccc(F)c(C(F)(F)F)c2)CCCCO1 |
| InChI | InChI=1S/C14H18F4N2O/c1-13(6-2-3-7-21-13)12(20-19)9-4-5-11(15)10(8-9)14(16,17)18/h4-5,8,12,20H,2-3,6-7,19H2,1H3 |
| InChIKey | JOBPFNYABDMDSR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|