C19H23N — CID 107292720
N-(cyclobutylmethyl)-2,2-diphenylethanamine (PubChem CID 107292720) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2,2-diphenylethanamine.
| Compound Name | N-(cyclobutylmethyl)-2,2-diphenylethanamine |
|---|---|
| PubChem CID | 107292720 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-(cyclobutylmethyl)-2,2-diphenylethanamine |
| SMILES | c1ccc(C(CNCC2CCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23N/c1-3-10-17(11-4-1)19(18-12-5-2-6-13-18)15-20-14-16-8-7-9-16/h1-6,10-13,16,19-20H,7-9,14-15H2 |
| InChIKey | UCBJZQXFFRBMKW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |