About 1-(cyclohexen-1-yl)-2,2-diphenylethanol
1-(cyclohexen-1-yl)-2,2-diphenylethanol (PubChem CID 107292880) has the molecular formula C20H22O
and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2,2-diphenylethanol.
Molecular Properties
| Compound Name | 1-(cyclohexen-1-yl)-2,2-diphenylethanol |
| PubChem CID | 107292880 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2,2-diphenylethanol |
| SMILES | OC(C1=CCCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-2,4-7,10-14,19-21H,3,8-9,15H2 |
| InChIKey | KGUKBLTWIXSDIW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexen-1-yl)-2,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexen-1-yl)-2,2-diphenylethanol?
The IUPAC name of 1-(cyclohexen-1-yl)-2,2-diphenylethanol (CID 107292880) is 1-(cyclohexen-1-yl)-2,2-diphenylethanol.
What is the SMILES notation for 1-(cyclohexen-1-yl)-2,2-diphenylethanol?
The canonical SMILES for 1-(cyclohexen-1-yl)-2,2-diphenylethanol is OC(C1=CCCCC1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-(cyclohexen-1-yl)-2,2-diphenylethanol?
The InChIKey is KGUKBLTWIXSDIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-2,4-7,10-14,19-21H,3,8-9,15H2.
What are the key properties of 1-(cyclohexen-1-yl)-2,2-diphenylethanol?
1-(cyclohexen-1-yl)-2,2-diphenylethanol has a molecular weight of 278.40 g/mol, XLogP of 4.68, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexen-1-yl)-2,2-diphenylethanol is sourced from PubChem (CID 107292880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).