C20H22O — CID 107292880
1-(cyclohexen-1-yl)-2,2-diphenylethanol (PubChem CID 107292880) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2,2-diphenylethanol.
| Compound Name | 1-(cyclohexen-1-yl)-2,2-diphenylethanol |
|---|---|
| PubChem CID | 107292880 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2,2-diphenylethanol |
| SMILES | OC(C1=CCCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-2,4-7,10-14,19-21H,3,8-9,15H2 |
| InChIKey | KGUKBLTWIXSDIW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|