C13H18N4OS — CID 1072934
3-(2,1,3-benzothiadiazol-5-yl)-1,1-di(propan-2-yl)urea (PubChem CID 1072934) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-5-yl)-1,1-di(propan-2-yl)urea.
| Compound Name | 3-(2,1,3-benzothiadiazol-5-yl)-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 1072934 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-5-yl)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)Nc1ccc2nsnc2c1)C(C)C |
| InChI | InChI=1S/C13H18N4OS/c1-8(2)17(9(3)4)13(18)14-10-5-6-11-12(7-10)16-19-15-11/h5-9H,1-4H3,(H,14,18) |
| InChIKey | KGGMLLZHZZVHJN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |