C17H18INO — CID 107293573
(3,3-dimethyl-2H-1-benzofuran-5-yl)-(2-iodophenyl)methanamine (PubChem CID 107293573) has the molecular formula C17H18INO and a molecular weight of 379.24 g/mol. Its IUPAC name is (3,3-dimethyl-2H-1-benzofuran-5-yl)-(2-iodophenyl)methanamine.
| Compound Name | (3,3-dimethyl-2H-1-benzofuran-5-yl)-(2-iodophenyl)methanamine |
|---|---|
| PubChem CID | 107293573 |
| Molecular Formula | C17H18INO |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (3,3-dimethyl-2H-1-benzofuran-5-yl)-(2-iodophenyl)methanamine |
| SMILES | CC1(C)COc2ccc(C(N)c3ccccc3I)cc21 |
| InChI | InChI=1S/C17H18INO/c1-17(2)10-20-15-8-7-11(9-13(15)17)16(19)12-5-3-4-6-14(12)18/h3-9,16H,10,19H2,1-2H3 |
| InChIKey | NSOWNRHZYFYJSB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|