C15H26OSi — CID 10729387
triethyl(2,3,4,5-tetrahydroinden-3a-yloxy)silane (PubChem CID 10729387) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is triethyl(2,3,4,5-tetrahydroinden-3a-yloxy)silane.
| Compound Name | triethyl(2,3,4,5-tetrahydroinden-3a-yloxy)silane |
|---|---|
| PubChem CID | 10729387 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | triethyl(2,3,4,5-tetrahydroinden-3a-yloxy)silane |
| SMILES | CC[Si](CC)(CC)OC12CCC=CC1=CCC2 |
| InChI | InChI=1S/C15H26OSi/c1-4-17(5-2,6-3)16-15-12-8-7-10-14(15)11-9-13-15/h7,10-11H,4-6,8-9,12-13H2,1-3H3 |
| InChIKey | ZTUPFRYJWWCCTE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|