C13H23N3O3S — CID 107297352
2-[4-(thiolan-3-ylmethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 107297352) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[4-(thiolan-3-ylmethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(thiolan-3-ylmethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 107297352 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[4-(thiolan-3-ylmethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)NCC2CCSC2)CC1 |
| InChI | InChI=1S/C13H23N3O3S/c17-12(18)9-15-3-1-4-16(6-5-15)13(19)14-8-11-2-7-20-10-11/h11H,1-10H2,(H,14,19)(H,17,18) |
| InChIKey | KEQZNNRYWNMZBZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |