C13H17N3O3S — CID 107297439
5-[(thiolan-3-ylmethylcarbamoylamino)methyl]pyridine-2-carboxylic acid (PubChem CID 107297439) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-[(thiolan-3-ylmethylcarbamoylamino)methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[(thiolan-3-ylmethylcarbamoylamino)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 107297439 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-[(thiolan-3-ylmethylcarbamoylamino)methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)nc1)NCC1CCSC1 |
| InChI | InChI=1S/C13H17N3O3S/c17-12(18)11-2-1-9(5-14-11)6-15-13(19)16-7-10-3-4-20-8-10/h1-2,5,10H,3-4,6-8H2,(H,17,18)(H2,15,16,19) |
| InChIKey | ZMCWRCKJAIBZEM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |