About 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid
3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid (PubChem CID 10729753) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid |
| PubChem CID | 10729753 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid |
| SMILES | CCOC(=O)[C@]1(CO)CCC=C[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C13H20O5/c1-2-18-12(17)13(9-14)8-4-3-5-10(13)6-7-11(15)16/h3,5,10,14H,2,4,6-9H2,1H3,(H,15,16)/t10-,13+/m1/s1 |
| InChIKey | HAIAMMXQGOSVOH-MFKMUULPSA-N |
| XLogP | 1.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid?
The IUPAC name of 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid (CID 10729753) is 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid.
What is the SMILES notation for 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid?
The canonical SMILES for 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid is CCOC(=O)[C@]1(CO)CCC=C[C@@H]1CCC(=O)O.
What is the InChIKey of 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid?
The InChIKey is HAIAMMXQGOSVOH-MFKMUULPSA-N. The full InChI is InChI=1S/C13H20O5/c1-2-18-12(17)13(9-14)8-4-3-5-10(13)6-7-11(15)16/h3,5,10,14H,2,4,6-9H2,1H3,(H,15,16)/t10-,13+/m1/s1.
What are the key properties of 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid?
3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid has a molecular weight of 256.30 g/mol, XLogP of 1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,6R)-6-ethoxycarbonyl-6-(hydroxymethyl)cyclohex-2-en-1-yl]propanoic acid is sourced from PubChem (CID 10729753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).