C16H20N2O — CID 10729785
5-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-imidazole (PubChem CID 10729785) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 5-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-imidazole.
| Compound Name | 5-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-imidazole |
|---|---|
| PubChem CID | 10729785 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 5-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-1H-imidazole |
| SMILES | c1ncc(CCCOc2ccc3c(c2)CCCC3)[nH]1 |
| InChI | InChI=1S/C16H20N2O/c1-2-5-14-10-16(8-7-13(14)4-1)19-9-3-6-15-11-17-12-18-15/h7-8,10-12H,1-6,9H2,(H,17,18) |
| InChIKey | XLZPWTDUULUNNH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|