About trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde
trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde (PubChem CID 10729801) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde |
| PubChem CID | 10729801 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCCC[C@H]1C=O |
| InChI | InChI=1S/C14H28O2Si/c1-14(2,3)17(4,5)16-11-13-9-7-6-8-12(13)10-15/h10,12-13H,6-9,11H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | KPOBJVMXTBUXRX-STQMWFEESA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde?
The IUPAC name of trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde (CID 10729801) is trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde.
What is the SMILES notation for trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde?
The canonical SMILES for trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde is CC(C)(C)[Si](C)(C)OC[C@@H]1CCCC[C@H]1C=O.
What is the InChIKey of trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde?
The InChIKey is KPOBJVMXTBUXRX-STQMWFEESA-N. The full InChI is InChI=1S/C14H28O2Si/c1-14(2,3)17(4,5)16-11-13-9-7-6-8-12(13)10-15/h10,12-13H,6-9,11H2,1-5H3/t12-,13-/m0/s1.
What are the key properties of trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde?
trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde has a molecular weight of 256.46 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde is sourced from PubChem (CID 10729801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).