C14H20ClN3OS — CID 107298139
2-chloro-6-(propylamino)-N-(thiolan-3-ylmethyl)pyridine-4-carboxamide (PubChem CID 107298139) has the molecular formula C14H20ClN3OS and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-chloro-6-(propylamino)-N-(thiolan-3-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(propylamino)-N-(thiolan-3-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107298139 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-chloro-6-(propylamino)-N-(thiolan-3-ylmethyl)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NCC2CCSC2)cc(Cl)n1 |
| InChI | InChI=1S/C14H20ClN3OS/c1-2-4-16-13-7-11(6-12(15)18-13)14(19)17-8-10-3-5-20-9-10/h6-7,10H,2-5,8-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | WQKQCFVZARXSBO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|