C15H19N3S — CID 107298291
2-cyclopropyl-1-(thiolan-3-ylmethyl)benzimidazol-5-amine (PubChem CID 107298291) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-cyclopropyl-1-(thiolan-3-ylmethyl)benzimidazol-5-amine.
| Compound Name | 2-cyclopropyl-1-(thiolan-3-ylmethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 107298291 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-cyclopropyl-1-(thiolan-3-ylmethyl)benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)nc(C1CC1)n2CC1CCSC1 |
| InChI | InChI=1S/C15H19N3S/c16-12-3-4-14-13(7-12)17-15(11-1-2-11)18(14)8-10-5-6-19-9-10/h3-4,7,10-11H,1-2,5-6,8-9,16H2 |
| InChIKey | WTMKPDPGSCIPEN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|